C10H10N2O — CID 104941371
(R)-1,3-oxazol-5-yl(phenyl)methanamine (PubChem CID 104941371) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is (R)-1,3-oxazol-5-yl(phenyl)methanamine.
| Compound Name | (R)-1,3-oxazol-5-yl(phenyl)methanamine |
|---|---|
| PubChem CID | 104941371 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (R)-1,3-oxazol-5-yl(phenyl)methanamine |
| SMILES | N[C@H](c1ccccc1)c1cnco1 |
| InChI | InChI=1S/C10H10N2O/c11-10(9-6-12-7-13-9)8-4-2-1-3-5-8/h1-7,10H,11H2/t10-/m1/s1 |
| InChIKey | KNSHXRALPAKWDT-SNVBAGLBSA-N |
| XLogP | 1.72 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |