C18H34O2Si — CID 10495201
(3R,3aS,7aR)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol (PubChem CID 10495201) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is (3R,3aS,7aR)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol.
| Compound Name | (3R,3aS,7aR)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol |
|---|---|
| PubChem CID | 10495201 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (3R,3aS,7aR)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/[C@H]1CC[C@H]2CCCC[C@]21O |
| InChI | InChI=1S/C18H34O2Si/c1-17(2,3)21(4,5)20-14-8-10-16-12-11-15-9-6-7-13-18(15,16)19/h8,10,15-16,19H,6-7,9,11-14H2,1-5H3/b10-8+/t15-,16+,18+/m1/s1 |
| InChIKey | WSEOJMCOYKPOCP-GSDQJTGLSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|