C20H32O3 — CID 10495957
(4'aS,8'aS)-4'-butyl-3',4'a,8',8'-tetramethylspiro[1,3-dioxolane-2,6'-1,5,7,8a-tetrahydronaphthalene]-2'-one (PubChem CID 10495957) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (4'aS,8'aS)-4'-butyl-3',4'a,8',8'-tetramethylspiro[1,3-dioxolane-2,6'-1,5,7,8a-tetrahydronaphthalene]-2'-one.
| Compound Name | (4'aS,8'aS)-4'-butyl-3',4'a,8',8'-tetramethylspiro[1,3-dioxolane-2,6'-1,5,7,8a-tetrahydronaphthalene]-2'-one |
|---|---|
| PubChem CID | 10495957 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (4'aS,8'aS)-4'-butyl-3',4'a,8',8'-tetramethylspiro[1,3-dioxolane-2,6'-1,5,7,8a-tetrahydronaphthalene]-2'-one |
| SMILES | CCCCC1=C(C)C(=O)C[C@H]2C(C)(C)CC3(C[C@]12C)OCCO3 |
| InChI | InChI=1S/C20H32O3/c1-6-7-8-15-14(2)16(21)11-17-18(3,4)12-20(13-19(15,17)5)22-9-10-23-20/h17H,6-13H2,1-5H3/t17-,19+/m0/s1 |
| InChIKey | YRXILSLQXLBUDB-PKOBYXMFSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |