C12H17F3N2O5 — CID 10496332
[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]azanium;2,2,2-trifluoroacetate (PubChem CID 10496332) has the molecular formula C12H17F3N2O5 and a molecular weight of 326.27 g/mol. Its IUPAC name is [(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]azanium;2,2,2-trifluoroacetate.
| Compound Name | [(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10496332 |
| Molecular Formula | C12H17F3N2O5 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | [(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]azanium;2,2,2-trifluoroacetate |
| SMILES | CC(C)[C@H]([NH3+])C(=O)[C@@H]1C(=O)NC(=O)[C@H]1C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C10H16N2O3.C2HF3O2/c1-4(2)7(11)8(13)6-5(3)9(14)12-10(6)15;3-2(4,5)1(6)7/h4-7H,11H2,1-3H3,(H,12,14,15);(H,6,7)/t5-,6+,7-;/m0./s1 |
| InChIKey | ARTMOFUDTCCBSZ-UHRUZOLSSA-N |
| XLogP | -1.97 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|