C22H15N7 — CID 10499814
2-(4-pyrazin-2-yl-2,5-dipyridin-2-yl-1H-pyrrol-3-yl)pyrazine (PubChem CID 10499814) has the molecular formula C22H15N7 and a molecular weight of 377.41 g/mol. Its IUPAC name is 2-(4-pyrazin-2-yl-2,5-dipyridin-2-yl-1H-pyrrol-3-yl)pyrazine.
| Compound Name | 2-(4-pyrazin-2-yl-2,5-dipyridin-2-yl-1H-pyrrol-3-yl)pyrazine |
|---|---|
| PubChem CID | 10499814 |
| Molecular Formula | C22H15N7 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-(4-pyrazin-2-yl-2,5-dipyridin-2-yl-1H-pyrrol-3-yl)pyrazine |
| SMILES | c1ccc(-c2[nH]c(-c3ccccn3)c(-c3cnccn3)c2-c2cnccn2)nc1 |
| InChI | InChI=1S/C22H15N7/c1-3-7-25-15(5-1)21-19(17-13-23-9-11-27-17)20(18-14-24-10-12-28-18)22(29-21)16-6-2-4-8-26-16/h1-14,29H |
| InChIKey | DJZBAIVNFZKYDU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |