C11H12BrF2N — CID 105005497
1-(4-bromo-2,6-difluorophenyl)-N,2-dimethylprop-2-en-1-amine (PubChem CID 105005497) has the molecular formula C11H12BrF2N and a molecular weight of 276.12 g/mol. Its IUPAC name is 1-(4-bromo-2,6-difluorophenyl)-N,2-dimethylprop-2-en-1-amine.
| Compound Name | 1-(4-bromo-2,6-difluorophenyl)-N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 105005497 |
| Molecular Formula | C11H12BrF2N |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 1-(4-bromo-2,6-difluorophenyl)-N,2-dimethylprop-2-en-1-amine |
| SMILES | C=C(C)C(NC)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H12BrF2N/c1-6(2)11(15-3)10-8(13)4-7(12)5-9(10)14/h4-5,11,15H,1H2,2-3H3 |
| InChIKey | TUVYKCZYUVNECN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|