C22H32O7Si — CID 10503086
1-O-methyl 1-O'-(2-trimethylsilylethyl) (1S,4S,6S)-4-hydroxy-6-[(4-methoxyphenyl)methoxy]cyclohex-2-ene-1,1-dicarboxylate (PubChem CID 10503086) has the molecular formula C22H32O7Si and a molecular weight of 436.58 g/mol. Its IUPAC name is 1-O-methyl 1-O'-(2-trimethylsilylethyl) (1S,4S,6S)-4-hydroxy-6-[(4-methoxyphenyl)methoxy]cyclohex-2-ene-1,1-dicarboxylate.
| Compound Name | 1-O-methyl 1-O'-(2-trimethylsilylethyl) (1S,4S,6S)-4-hydroxy-6-[(4-methoxyphenyl)methoxy]cyclohex-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10503086 |
| Molecular Formula | C22H32O7Si |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 1-O-methyl 1-O'-(2-trimethylsilylethyl) (1S,4S,6S)-4-hydroxy-6-[(4-methoxyphenyl)methoxy]cyclohex-2-ene-1,1-dicarboxylate |
| SMILES | COC(=O)[C@]1(C(=O)OCC[Si](C)(C)C)C=C[C@@H](O)C[C@@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H32O7Si/c1-26-18-8-6-16(7-9-18)15-29-19-14-17(23)10-11-22(19,20(24)27-2)21(25)28-12-13-30(3,4)5/h6-11,17,19,23H,12-15H2,1-5H3/t17-,19+,22+/m1/s1 |
| InChIKey | IIXMRQXIKBCDAP-LZNRXBQRSA-N |
| XLogP | 2.94 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|