C19H26O4Si — CID 11462133
(2E,5Z,7R,8R)-8-hydroxy-7-[(4-methoxyphenyl)methoxy]-3-trimethylsilylcycloocta-2,5-dien-1-one (PubChem CID 11462133) has the molecular formula C19H26O4Si and a molecular weight of 346.50 g/mol. Its IUPAC name is (2E,5Z,7R,8R)-8-hydroxy-7-[(4-methoxyphenyl)methoxy]-3-trimethylsilylcycloocta-2,5-dien-1-one.
| Compound Name | (2E,5Z,7R,8R)-8-hydroxy-7-[(4-methoxyphenyl)methoxy]-3-trimethylsilylcycloocta-2,5-dien-1-one |
|---|---|
| PubChem CID | 11462133 |
| Molecular Formula | C19H26O4Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (2E,5Z,7R,8R)-8-hydroxy-7-[(4-methoxyphenyl)methoxy]-3-trimethylsilylcycloocta-2,5-dien-1-one |
| SMILES | COc1ccc(CO[C@@H]2/C=C\C/C([Si](C)(C)C)=C\C(=O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C19H26O4Si/c1-22-15-10-8-14(9-11-15)13-23-18-7-5-6-16(24(2,3)4)12-17(20)19(18)21/h5,7-12,18-19,21H,6,13H2,1-4H3/b7-5-,16-12+/t18-,19+/m1/s1 |
| InChIKey | CUUXHDDSGFIIKH-BXMVMEAASA-N |
| XLogP | 3.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|