C32H50O5Si — CID 15818326
(1R,2R,3R,4'S,4aR,6S,8aR)-1-ethenyl-6-[(4-methoxyphenyl)methoxy]-5,5,8a-trimethyl-4'-(2-trimethylsilylethoxy)spiro[3,4,4a,6,7,8-hexahydronaphthalene-2,3'-cyclopentene]-1,3-diol (PubChem CID 15818326) has the molecular formula C32H50O5Si and a molecular weight of 542.83 g/mol. Its IUPAC name is (1R,2R,3R,4'S,4aR,6S,8aR)-1-ethenyl-6-[(4-methoxyphenyl)methoxy]-5,5,8a-trimethyl-4'-(2-trimethylsilylethoxy)spiro[3,4,4a,6,7,8-hexahydronaphthalene-2,3'-cyclopentene]-1,3-diol.
| Compound Name | (1R,2R,3R,4'S,4aR,6S,8aR)-1-ethenyl-6-[(4-methoxyphenyl)methoxy]-5,5,8a-trimethyl-4'-(2-trimethylsilylethoxy)spiro[3,4,4a,6,7,8-hexahydronaphthalene-2,3'-cyclopentene]-1,3-diol |
|---|---|
| PubChem CID | 15818326 |
| Molecular Formula | C32H50O5Si |
| Molecular Weight | 542.83 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | (1R,2R,3R,4'S,4aR,6S,8aR)-1-ethenyl-6-[(4-methoxyphenyl)methoxy]-5,5,8a-trimethyl-4'-(2-trimethylsilylethoxy)spiro[3,4,4a,6,7,8-hexahydronaphthalene-2,3'-cyclopentene]-1,3-diol |
| SMILES | C=C[C@]1(O)[C@]2(C=CC[C@@H]2OCC[Si](C)(C)C)[C@H](O)C[C@@H]2C(C)(C)[C@@H](OCc3ccc(OC)cc3)CC[C@]21C |
| InChI | InChI=1S/C32H50O5Si/c1-9-32(34)30(4)18-16-27(37-22-23-12-14-24(35-5)15-13-23)29(2,3)25(30)21-26(33)31(32)17-10-11-28(31)36-19-20-38(6,7)8/h9-10,12-15,17,25-28,33-34H,1,11,16,18-22H2,2-8H3/t25-,26-,27+,28+,30-,31-,32-/m1/s1 |
| InChIKey | ULBWPWUMSUXXAC-XJHUJQOXSA-N |
| XLogP | 6.37 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.83 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|