C29H38O8Si — CID 101002969
2-O-methyl 2-O'-(2-trimethylsilylethyl) (1R,3S,5R,6S)-3-[(4-methoxyphenyl)methoxy]-5-phenylmethoxy-7-oxabicyclo[4.1.0]heptane-2,2-dicarboxylate (PubChem CID 101002969) has the molecular formula C29H38O8Si and a molecular weight of 542.70 g/mol. Its IUPAC name is 2-O-methyl 2-O'-(2-trimethylsilylethyl) (1R,3S,5R,6S)-3-[(4-methoxyphenyl)methoxy]-5-phenylmethoxy-7-oxabicyclo[4.1.0]heptane-2,2-dicarboxylate.
| Compound Name | 2-O-methyl 2-O'-(2-trimethylsilylethyl) (1R,3S,5R,6S)-3-[(4-methoxyphenyl)methoxy]-5-phenylmethoxy-7-oxabicyclo[4.1.0]heptane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101002969 |
| Molecular Formula | C29H38O8Si |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 2-O-methyl 2-O'-(2-trimethylsilylethyl) (1R,3S,5R,6S)-3-[(4-methoxyphenyl)methoxy]-5-phenylmethoxy-7-oxabicyclo[4.1.0]heptane-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OCC[Si](C)(C)C)[C@@H](OCc2ccc(OC)cc2)C[C@@H](OCc2ccccc2)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C29H38O8Si/c1-32-22-13-11-21(12-14-22)19-36-24-17-23(35-18-20-9-7-6-8-10-20)25-26(37-25)29(24,27(30)33-2)28(31)34-15-16-38(3,4)5/h6-14,23-26H,15-19H2,1-5H3/t23-,24+,25+,26+,29?/m1/s1 |
| InChIKey | HXAOJEPCBQMKNF-HTXVTRAASA-N |
| XLogP | 4.38 |
| TPSA | 92.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|