C21H28O6 — CID 58237300
dimethyl 6-[(4-methoxyphenyl)methoxy]-1-prop-2-enylcyclohexane-1,3-dicarboxylate (PubChem CID 58237300) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is dimethyl 6-[(4-methoxyphenyl)methoxy]-1-prop-2-enylcyclohexane-1,3-dicarboxylate.
| Compound Name | dimethyl 6-[(4-methoxyphenyl)methoxy]-1-prop-2-enylcyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 58237300 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | dimethyl 6-[(4-methoxyphenyl)methoxy]-1-prop-2-enylcyclohexane-1,3-dicarboxylate |
| SMILES | C=CCC1(C(=O)OC)CC(C(=O)OC)CCC1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H28O6/c1-5-12-21(20(23)26-4)13-16(19(22)25-3)8-11-18(21)27-14-15-6-9-17(24-2)10-7-15/h5-7,9-10,16,18H,1,8,11-14H2,2-4H3 |
| InChIKey | PQLNMKYGCZGVED-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|