C20H25NO6 — CID 170159159
(3aS,6aS)-3-[(4-methoxyphenyl)methoxy]-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]pyrrole-1,6a-dicarboxylic acid (PubChem CID 170159159) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is (3aS,6aS)-3-[(4-methoxyphenyl)methoxy]-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]pyrrole-1,6a-dicarboxylic acid.
| Compound Name | (3aS,6aS)-3-[(4-methoxyphenyl)methoxy]-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]pyrrole-1,6a-dicarboxylic acid |
|---|---|
| PubChem CID | 170159159 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (3aS,6aS)-3-[(4-methoxyphenyl)methoxy]-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]pyrrole-1,6a-dicarboxylic acid |
| SMILES | C=CC[C@@]12CCC[C@]1(C(=O)O)N(C(=O)O)CC2OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H25NO6/c1-3-9-19-10-4-11-20(19,17(22)23)21(18(24)25)12-16(19)27-13-14-5-7-15(26-2)8-6-14/h3,5-8,16H,1,4,9-13H2,2H3,(H,22,23)(H,24,25)/t16?,19-,20+/m0/s1 |
| InChIKey | JYFYOQQRWUXBCP-KHMGXFTDSA-N |
| XLogP | 3.14 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|