C30H40O4 — CID 10504339
[(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)but-2-enyl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 10504339) has the molecular formula C30H40O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is [(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)but-2-enyl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | [(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)but-2-enyl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 10504339 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | [(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)but-2-enyl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC/C=C(\C)C2=CC(=O)C(C)(C)O2)C(C)(C)CCC1 |
| InChI | InChI=1S/C30H40O4/c1-21(14-15-25-23(3)13-10-17-29(25,5)6)11-9-12-22(2)19-28(32)33-18-16-24(4)26-20-27(31)30(7,8)34-26/h9,11-12,14-16,19-20H,10,13,17-18H2,1-8H3/b12-9+,15-14+,21-11+,22-19+,24-16+ |
| InChIKey | VYYQKIQWXFMNRL-HOYIZPTQSA-N |
| XLogP | 7.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|