C9H8N2S3 — CID 10514216
3-methylsulfanyl-6-phenyl-1,4,2,5-dithiadiazine (PubChem CID 10514216) has the molecular formula C9H8N2S3 and a molecular weight of 240.38 g/mol. Its IUPAC name is 3-methylsulfanyl-6-phenyl-1,4,2,5-dithiadiazine.
| Compound Name | 3-methylsulfanyl-6-phenyl-1,4,2,5-dithiadiazine |
|---|---|
| PubChem CID | 10514216 |
| Molecular Formula | C9H8N2S3 |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 3-methylsulfanyl-6-phenyl-1,4,2,5-dithiadiazine |
| SMILES | CSC1=NSC(c2ccccc2)=NS1 |
| InChI | InChI=1S/C9H8N2S3/c1-12-9-11-13-8(10-14-9)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | YLHPAHZVMAEPFL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|