C13H18N2 — CID 105149189
4-(1-aminopent-4-ynyl)-N,N-dimethylaniline (PubChem CID 105149189) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-(1-aminopent-4-ynyl)-N,N-dimethylaniline.
| Compound Name | 4-(1-aminopent-4-ynyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 105149189 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 4-(1-aminopent-4-ynyl)-N,N-dimethylaniline |
| SMILES | C#CCCC(N)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C13H18N2/c1-4-5-6-13(14)11-7-9-12(10-8-11)15(2)3/h1,7-10,13H,5-6,14H2,2-3H3 |
| InChIKey | DCLUWEACWIWLAH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|