C16H14N2O3S — CID 10519329
1,1-dioxospiro[1,2,5-thiadiazolidine-4,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene]-3-one (PubChem CID 10519329) has the molecular formula C16H14N2O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is 1,1-dioxospiro[1,2,5-thiadiazolidine-4,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene]-3-one.
| Compound Name | 1,1-dioxospiro[1,2,5-thiadiazolidine-4,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene]-3-one |
|---|---|
| PubChem CID | 10519329 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1,1-dioxospiro[1,2,5-thiadiazolidine-4,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene]-3-one |
| SMILES | O=C1NS(=O)(=O)NC12c1ccccc1CCc1ccccc12 |
| InChI | InChI=1S/C16H14N2O3S/c19-15-16(18-22(20,21)17-15)13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)16/h1-8,18H,9-10H2,(H,17,19) |
| InChIKey | UTCMESDDQLUDSC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |