C18H20N6O3 — CID 10523047
1-[3-(1H-imidazol-5-yl)propyl]-3-[4-(5-methyl-2-oxo-1,3-dihydroimidazole-4-carbonyl)phenyl]urea (PubChem CID 10523047) has the molecular formula C18H20N6O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is 1-[3-(1H-imidazol-5-yl)propyl]-3-[4-(5-methyl-2-oxo-1,3-dihydroimidazole-4-carbonyl)phenyl]urea.
| Compound Name | 1-[3-(1H-imidazol-5-yl)propyl]-3-[4-(5-methyl-2-oxo-1,3-dihydroimidazole-4-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 10523047 |
| Molecular Formula | C18H20N6O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-[3-(1H-imidazol-5-yl)propyl]-3-[4-(5-methyl-2-oxo-1,3-dihydroimidazole-4-carbonyl)phenyl]urea |
| SMILES | Cc1[nH]c(=O)[nH]c1C(=O)c1ccc(NC(=O)NCCCc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C18H20N6O3/c1-11-15(24-18(27)22-11)16(25)12-4-6-13(7-5-12)23-17(26)20-8-2-3-14-9-19-10-21-14/h4-7,9-10H,2-3,8H2,1H3,(H,19,21)(H2,20,23,26)(H2,22,24,27) |
| InChIKey | JULLWHBHAROCEC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|