C9H17N5 — CID 105230814
4-(1-hydrazinylpent-4-enyl)-1-methylpyrazol-5-amine (PubChem CID 105230814) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-(1-hydrazinylpent-4-enyl)-1-methylpyrazol-5-amine.
| Compound Name | 4-(1-hydrazinylpent-4-enyl)-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 105230814 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 4-(1-hydrazinylpent-4-enyl)-1-methylpyrazol-5-amine |
| SMILES | C=CCCC(NN)c1cnn(C)c1N |
| InChI | InChI=1S/C9H17N5/c1-3-4-5-8(13-11)7-6-12-14(2)9(7)10/h3,6,8,13H,1,4-5,10-11H2,2H3 |
| InChIKey | JLOSLZZMTIQYJE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|