C20H27ClOSe — CID 10524885
(1S,5R,7R)-3-chloro-10,10-dimethyl-3-[(E)-4-phenylbut-2-enyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decane (PubChem CID 10524885) has the molecular formula C20H27ClOSe and a molecular weight of 397.85 g/mol. Its IUPAC name is (1S,5R,7R)-3-chloro-10,10-dimethyl-3-[(E)-4-phenylbut-2-enyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decane.
| Compound Name | (1S,5R,7R)-3-chloro-10,10-dimethyl-3-[(E)-4-phenylbut-2-enyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decane |
|---|---|
| PubChem CID | 10524885 |
| Molecular Formula | C20H27ClOSe |
| Molecular Weight | 397.85 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | (1S,5R,7R)-3-chloro-10,10-dimethyl-3-[(E)-4-phenylbut-2-enyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decane |
| SMILES | CC1(C)[C@@H]2CC[C@]13C[Se](Cl)(C/C=C/Cc1ccccc1)O[C@@H]3C2 |
| InChI | InChI=1S/C20H27ClOSe/c1-19(2)17-11-12-20(19)15-23(21,22-18(20)14-17)13-7-6-10-16-8-4-3-5-9-16/h3-9,17-18H,10-15H2,1-2H3/b7-6+/t17-,18-,20-/m1/s1 |
| InChIKey | CNVJRYZNXGGASK-YLFWBSLLSA-N |
| XLogP | 5.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.85 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|