C16H27ClOSe — CID 139266442
(5R)-3-chloro-10,10-dimethyl-3-[(E)-4-methylpent-2-enyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decane (PubChem CID 139266442) has the molecular formula C16H27ClOSe and a molecular weight of 349.80 g/mol. Its IUPAC name is (5R)-3-chloro-10,10-dimethyl-3-[(E)-4-methylpent-2-enyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decane.
| Compound Name | (5R)-3-chloro-10,10-dimethyl-3-[(E)-4-methylpent-2-enyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decane |
|---|---|
| PubChem CID | 139266442 |
| Molecular Formula | C16H27ClOSe |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | (5R)-3-chloro-10,10-dimethyl-3-[(E)-4-methylpent-2-enyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decane |
| SMILES | CC(C)/C=C/C[Se@]1(Cl)CC23CCC(C[C@H]2O1)C3(C)C |
| InChI | InChI=1S/C16H27ClOSe/c1-12(2)6-5-9-19(17)11-16-8-7-13(15(16,3)4)10-14(16)18-19/h5-6,12-14H,7-11H2,1-4H3/b6-5+/t13?,14-,16?/m1/s1 |
| InChIKey | SDGCDZDKYIHOJB-ICRLJHHTSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|