C11H19ClOTe — CID 85313585
3-chloro-3,10,10-trimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decane (PubChem CID 85313585) has the molecular formula C11H19ClOTe and a molecular weight of 330.33 g/mol. Its IUPAC name is 3-chloro-3,10,10-trimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decane.
| Compound Name | 3-chloro-3,10,10-trimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decane |
|---|---|
| PubChem CID | 85313585 |
| Molecular Formula | C11H19ClOTe |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 3-chloro-3,10,10-trimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decane |
| SMILES | CC1(C)C2CCC13C[Te](C)(Cl)OC3C2 |
| InChI | InChI=1S/C11H19ClOTe/c1-10(2)8-4-5-11(10)7-14(3,12)13-9(11)6-8/h8-9H,4-7H2,1-3H3 |
| InChIKey | HPNBAPMXJYCJPT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|