C10H16O3S — CID 13183373
10,10-dimethyl-4-oxa-3lambda6-thiatricyclo[5.2.1.01,5]decane 3,3-dioxide (PubChem CID 13183373) has the molecular formula C10H16O3S and a molecular weight of 216.30 g/mol. Its IUPAC name is 10,10-dimethyl-4-oxa-3lambda6-thiatricyclo[5.2.1.01,5]decane 3,3-dioxide.
| Compound Name | 10,10-dimethyl-4-oxa-3lambda6-thiatricyclo[5.2.1.01,5]decane 3,3-dioxide |
|---|---|
| PubChem CID | 13183373 |
| Molecular Formula | C10H16O3S |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 10,10-dimethyl-4-oxa-3lambda6-thiatricyclo[5.2.1.01,5]decane 3,3-dioxide |
| SMILES | CC1(C)C2CCC13CS(=O)(=O)OC3C2 |
| InChI | InChI=1S/C10H16O3S/c1-9(2)7-3-4-10(9)6-14(11,12)13-8(10)5-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | WPANITOANUCSAR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|