About (4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane
(4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane (PubChem CID 134986465) has the molecular formula C12H17Cl3OS
and a molecular weight of 315.69 g/mol. Its IUPAC name is (4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane.
Molecular Properties
| Compound Name | (4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane |
| PubChem CID | 134986465 |
| Molecular Formula | C12H17Cl3OS |
| Molecular Weight | 315.69 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | (4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane |
| SMILES | CC1(C)C2CCC13CS[C@H](C(Cl)(Cl)Cl)OC3C2 |
| InChI | InChI=1S/C12H17Cl3OS/c1-10(2)7-3-4-11(10)6-17-9(12(13,14)15)16-8(11)5-7/h7-9H,3-6H2,1-2H3/t7?,8?,9-,11?/m1/s1 |
| InChIKey | ZLXOVFOYDBPEKG-CHNYNBFLSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.69 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane?
The IUPAC name of (4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane (CID 134986465) is (4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane.
What is the SMILES notation for (4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane?
The canonical SMILES for (4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane is CC1(C)C2CCC13CS[C@H](C(Cl)(Cl)Cl)OC3C2.
What is the InChIKey of (4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane?
The InChIKey is ZLXOVFOYDBPEKG-CHNYNBFLSA-N. The full InChI is InChI=1S/C12H17Cl3OS/c1-10(2)7-3-4-11(10)6-17-9(12(13,14)15)16-8(11)5-7/h7-9H,3-6H2,1-2H3/t7?,8?,9-,11?/m1/s1.
What are the key properties of (4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane?
(4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane has a molecular weight of 315.69 g/mol, XLogP of 4.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-11,11-dimethyl-4-(trichloromethyl)-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane is sourced from PubChem (CID 134986465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).