C12H21ClOTe — CID 139266369
(3S,5R)-3-chloro-3-ethyl-10,10-dimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decane (PubChem CID 139266369) has the molecular formula C12H21ClOTe and a molecular weight of 344.35 g/mol. Its IUPAC name is (3S,5R)-3-chloro-3-ethyl-10,10-dimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decane.
| Compound Name | (3S,5R)-3-chloro-3-ethyl-10,10-dimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decane |
|---|---|
| PubChem CID | 139266369 |
| Molecular Formula | C12H21ClOTe |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | (3S,5R)-3-chloro-3-ethyl-10,10-dimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decane |
| SMILES | CC[Te@]1(Cl)CC23CCC(C[C@H]2O1)C3(C)C |
| InChI | InChI=1S/C12H21ClOTe/c1-4-15(13)8-12-6-5-9(11(12,2)3)7-10(12)14-15/h9-10H,4-8H2,1-3H3/t9?,10-,12?/m1/s1 |
| InChIKey | ZXKZUZMWSNROJG-SQLBVSGCSA-N |
| XLogP | 3.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|