C14H25BrOTe — CID 10621868
(1S,5R,7R)-3-bromo-3-butyl-10,10-dimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decane (PubChem CID 10621868) has the molecular formula C14H25BrOTe and a molecular weight of 416.86 g/mol. Its IUPAC name is (1S,5R,7R)-3-bromo-3-butyl-10,10-dimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decane.
| Compound Name | (1S,5R,7R)-3-bromo-3-butyl-10,10-dimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decane |
|---|---|
| PubChem CID | 10621868 |
| Molecular Formula | C14H25BrOTe |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | (1S,5R,7R)-3-bromo-3-butyl-10,10-dimethyl-4-oxa-3λ4-telluratricyclo[5.2.1.01,5]decane |
| SMILES | CCCC[Te]1(Br)C[C@]23CC[C@H](C[C@H]2O1)C3(C)C |
| InChI | InChI=1S/C14H25BrOTe/c1-4-5-8-17(15)10-14-7-6-11(13(14,2)3)9-12(14)16-17/h11-12H,4-10H2,1-3H3/t11-,12-,14-/m1/s1 |
| InChIKey | JWNCLNBKEDNEAO-YRGRVCCFSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|