About 4,11,11-trimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane
4,11,11-trimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane (PubChem CID 85316647) has the molecular formula C12H20OS
and a molecular weight of 212.36 g/mol. Its IUPAC name is 4,11,11-trimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane.
Analyze 4,11,11-trimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,11,11-trimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane?
The IUPAC name of 4,11,11-trimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane (CID 85316647) is 4,11,11-trimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane.
What is the SMILES notation for 4,11,11-trimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane?
The canonical SMILES for 4,11,11-trimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane is CC1OC2CC3CCC2(CS1)C3(C)C.
What is the InChIKey of 4,11,11-trimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane?
The InChIKey is IERBHYZLSIUTEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20OS/c1-8-13-10-6-9-4-5-12(10,7-14-8)11(9,2)3/h8-10H,4-7H2,1-3H3.
What are the key properties of 4,11,11-trimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane?
4,11,11-trimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane has a molecular weight of 212.36 g/mol, XLogP of 3.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,11,11-trimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane is sourced from PubChem (CID 85316647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).