C23H27O2PS — CID 102047202
[(1S,4S,6R,8R)-11,11-dimethyl-3-oxo-5-oxa-3λ4-thiatricyclo[6.2.1.01,6]undecan-4-yl]-diphenylphosphane (PubChem CID 102047202) has the molecular formula C23H27O2PS and a molecular weight of 398.51 g/mol. Its IUPAC name is [(1S,4S,6R,8R)-11,11-dimethyl-3-oxo-5-oxa-3λ4-thiatricyclo[6.2.1.01,6]undecan-4-yl]-diphenylphosphane.
| Compound Name | [(1S,4S,6R,8R)-11,11-dimethyl-3-oxo-5-oxa-3λ4-thiatricyclo[6.2.1.01,6]undecan-4-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 102047202 |
| Molecular Formula | C23H27O2PS |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [(1S,4S,6R,8R)-11,11-dimethyl-3-oxo-5-oxa-3λ4-thiatricyclo[6.2.1.01,6]undecan-4-yl]-diphenylphosphane |
| SMILES | CC1(C)[C@@H]2CC[C@]13CS(=O)[C@H](P(c1ccccc1)c1ccccc1)O[C@@H]3C2 |
| InChI | InChI=1S/C23H27O2PS/c1-22(2)17-13-14-23(22)16-27(24)21(25-20(23)15-17)26(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,17,20-21H,13-16H2,1-2H3/t17-,20-,21+,23-,27?/m1/s1 |
| InChIKey | GRDWKZYVTCTSSQ-VRRWMFERSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|