C36H38NOP — CID 101128144
[2-[(1R,8R)-3-benzyl-11,11-dimethyl-5-oxa-3-azatricyclo[6.2.1.01,6]undecan-4-yl]phenyl]-diphenylphosphane (PubChem CID 101128144) has the molecular formula C36H38NOP and a molecular weight of 531.68 g/mol. Its IUPAC name is [2-[(1R,8R)-3-benzyl-11,11-dimethyl-5-oxa-3-azatricyclo[6.2.1.01,6]undecan-4-yl]phenyl]-diphenylphosphane.
| Compound Name | [2-[(1R,8R)-3-benzyl-11,11-dimethyl-5-oxa-3-azatricyclo[6.2.1.01,6]undecan-4-yl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 101128144 |
| Molecular Formula | C36H38NOP |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | [2-[(1R,8R)-3-benzyl-11,11-dimethyl-5-oxa-3-azatricyclo[6.2.1.01,6]undecan-4-yl]phenyl]-diphenylphosphane |
| SMILES | CC1(C)[C@@H]2CC[C@]13CN(Cc1ccccc1)C(c1ccccc1P(c1ccccc1)c1ccccc1)OC3C2 |
| InChI | InChI=1S/C36H38NOP/c1-35(2)28-22-23-36(35)26-37(25-27-14-6-3-7-15-27)34(38-33(36)24-28)31-20-12-13-21-32(31)39(29-16-8-4-9-17-29)30-18-10-5-11-19-30/h3-21,28,33-34H,22-26H2,1-2H3/t28-,33?,34?,36-/m1/s1 |
| InChIKey | MYEXHHRAVRMCCG-ULQIXOPOSA-N |
| XLogP | 7.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|