C16H21OSe+ — CID 10699038
(1S,5R,7R)-10,10-dimethyl-3-phenyl-4-oxa-3-selenoniatricyclo[5.2.1.01,5]decane (PubChem CID 10699038) has the molecular formula C16H21OSe+ and a molecular weight of 308.30 g/mol. Its IUPAC name is (1S,5R,7R)-10,10-dimethyl-3-phenyl-4-oxa-3-selenoniatricyclo[5.2.1.01,5]decane.
| Compound Name | (1S,5R,7R)-10,10-dimethyl-3-phenyl-4-oxa-3-selenoniatricyclo[5.2.1.01,5]decane |
|---|---|
| PubChem CID | 10699038 |
| Molecular Formula | C16H21OSe+ |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | (1S,5R,7R)-10,10-dimethyl-3-phenyl-4-oxa-3-selenoniatricyclo[5.2.1.01,5]decane |
| SMILES | CC1(C)[C@@H]2CC[C@]13C[Se+](c1ccccc1)O[C@@H]3C2 |
| InChI | InChI=1S/C16H21OSe/c1-15(2)12-8-9-16(15)11-18(17-14(16)10-12)13-6-4-3-5-7-13/h3-7,12,14H,8-11H2,1-2H3/q+1/t12-,14-,16-,18?/m1/s1 |
| InChIKey | DPTJTRYBHIHRGZ-WNDUXJAYSA-N |
| XLogP | 3.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|