C12H18O — CID 162911062
(1S,4R,7S,9S,11R)-11-methyl-8-oxatetracyclo[5.3.2.04,9.04,11]dodecane (PubChem CID 162911062) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (1S,4R,7S,9S,11R)-11-methyl-8-oxatetracyclo[5.3.2.04,9.04,11]dodecane.
| Compound Name | (1S,4R,7S,9S,11R)-11-methyl-8-oxatetracyclo[5.3.2.04,9.04,11]dodecane |
|---|---|
| PubChem CID | 162911062 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (1S,4R,7S,9S,11R)-11-methyl-8-oxatetracyclo[5.3.2.04,9.04,11]dodecane |
| SMILES | C[C@]12C[C@@H]3CC[C@]14CC[C@H]2C[C@@H]4O3 |
| InChI | InChI=1S/C12H18O/c1-11-7-9-3-5-12(11)4-2-8(11)6-10(12)13-9/h8-10H,2-7H2,1H3/t8-,9-,10-,11+,12-/m0/s1 |
| InChIKey | VGGSAEFRUODTIJ-NGDQXYMTSA-N |
| XLogP | 2.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |