C18H26O4SSe — CID 139266196
(3,10,10-trimethyl-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl) 4-methylbenzenesulfonate (PubChem CID 139266196) has the molecular formula C18H26O4SSe and a molecular weight of 417.43 g/mol. Its IUPAC name is (3,10,10-trimethyl-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl) 4-methylbenzenesulfonate.
| Compound Name | (3,10,10-trimethyl-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139266196 |
| Molecular Formula | C18H26O4SSe |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | (3,10,10-trimethyl-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[Se]2(C)CC34CCC(CC3O2)C4(C)C)cc1 |
| InChI | InChI=1S/C18H26O4SSe/c1-13-5-7-15(8-6-13)23(19,20)22-24(4)12-18-10-9-14(17(18,2)3)11-16(18)21-24/h5-8,14,16H,9-12H2,1-4H3 |
| InChIKey | ZHMQXVLZSFGSCW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|