C27H34OS — CID 10525416
[(1E,3E)-2-methyl-4-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxybuta-1,3-dienyl]sulfanylbenzene (PubChem CID 10525416) has the molecular formula C27H34OS and a molecular weight of 406.64 g/mol. Its IUPAC name is [(1E,3E)-2-methyl-4-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxybuta-1,3-dienyl]sulfanylbenzene.
| Compound Name | [(1E,3E)-2-methyl-4-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxybuta-1,3-dienyl]sulfanylbenzene |
|---|---|
| PubChem CID | 10525416 |
| Molecular Formula | C27H34OS |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | [(1E,3E)-2-methyl-4-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxybuta-1,3-dienyl]sulfanylbenzene |
| SMILES | CC(/C=C/O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1)=C\Sc1ccccc1 |
| InChI | InChI=1S/C27H34OS/c1-21-15-16-25(27(3,4)23-11-7-5-8-12-23)26(19-21)28-18-17-22(2)20-29-24-13-9-6-10-14-24/h5-14,17-18,20-21,25-26H,15-16,19H2,1-4H3/b18-17+,22-20+/t21-,25-,26-/m1/s1 |
| InChIKey | DXRBQWCKQRDBHT-ZAZOZCEKSA-N |
| XLogP | 8.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|