C28H42OS — CID 140632986
tert-butyl-[4,4-di(propan-2-yl)cyclohexyl]oxy-diphenyl-λ4-sulfane (PubChem CID 140632986) has the molecular formula C28H42OS and a molecular weight of 426.71 g/mol. Its IUPAC name is tert-butyl-[4,4-di(propan-2-yl)cyclohexyl]oxy-diphenyl-λ4-sulfane.
| Compound Name | tert-butyl-[4,4-di(propan-2-yl)cyclohexyl]oxy-diphenyl-λ4-sulfane |
|---|---|
| PubChem CID | 140632986 |
| Molecular Formula | C28H42OS |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | tert-butyl-[4,4-di(propan-2-yl)cyclohexyl]oxy-diphenyl-λ4-sulfane |
| SMILES | CC(C)C1(C(C)C)CCC(OS(c2ccccc2)(c2ccccc2)C(C)(C)C)CC1 |
| InChI | InChI=1S/C28H42OS/c1-22(2)28(23(3)4)20-18-24(19-21-28)29-30(27(5,6)7,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-17,22-24H,18-21H2,1-7H3 |
| InChIKey | PBJURJTUZXDNIT-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |