C28H52O3Si — CID 10528133
[(3aR,4S,7aS)-1-[(1S)-1-cyclopropyl-5-(methoxymethoxy)-5-methylhexyl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10528133) has the molecular formula C28H52O3Si and a molecular weight of 464.81 g/mol. Its IUPAC name is [(3aR,4S,7aS)-1-[(1S)-1-cyclopropyl-5-(methoxymethoxy)-5-methylhexyl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4S,7aS)-1-[(1S)-1-cyclopropyl-5-(methoxymethoxy)-5-methylhexyl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10528133 |
| Molecular Formula | C28H52O3Si |
| Molecular Weight | 464.81 g/mol |
| Exact Mass | 464.37 |
| IUPAC Name | [(3aR,4S,7aS)-1-[(1S)-1-cyclopropyl-5-(methoxymethoxy)-5-methylhexyl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COCOC(C)(C)CCC[C@H](C1=CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C)C1CC1 |
| InChI | InChI=1S/C28H52O3Si/c1-26(2,3)32(8,9)31-25-13-11-19-28(6)23(16-17-24(25)28)22(21-14-15-21)12-10-18-27(4,5)30-20-29-7/h16,21-22,24-25H,10-15,17-20H2,1-9H3/t22-,24-,25-,28+/m0/s1 |
| InChIKey | OUZXLCSAYNAXRA-JCUKEYOKSA-N |
| XLogP | 8.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.81 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|