C28H52O3Si — CID 10576119
[(1R,3aR,4S,7aR)-1-[(E,2R,3R)-3-ethenyl-6-(methoxymethoxy)-6-methylhept-4-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10576119) has the molecular formula C28H52O3Si and a molecular weight of 464.81 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(E,2R,3R)-3-ethenyl-6-(methoxymethoxy)-6-methylhept-4-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(E,2R,3R)-3-ethenyl-6-(methoxymethoxy)-6-methylhept-4-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10576119 |
| Molecular Formula | C28H52O3Si |
| Molecular Weight | 464.81 g/mol |
| Exact Mass | 464.37 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(E,2R,3R)-3-ethenyl-6-(methoxymethoxy)-6-methylhept-4-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CC(/C=C/C(C)(C)OCOC)[C@@H](C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C28H52O3Si/c1-12-22(17-19-27(6,7)30-20-29-9)21(2)23-15-16-24-25(14-13-18-28(23,24)8)31-32(10,11)26(3,4)5/h12,17,19,21-25H,1,13-16,18,20H2,2-11H3/b19-17+/t21-,22?,23-,24+,25+,28-/m1/s1 |
| InChIKey | YIHXBMGCWWKWJJ-LJGKKWKJSA-N |
| XLogP | 7.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.81 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|