C29H35NO4Si — CID 10529070
(3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(phenylmethoxymethoxy)pyrrolidin-2-one (PubChem CID 10529070) has the molecular formula C29H35NO4Si and a molecular weight of 489.69 g/mol. Its IUPAC name is (3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(phenylmethoxymethoxy)pyrrolidin-2-one.
| Compound Name | (3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(phenylmethoxymethoxy)pyrrolidin-2-one |
|---|---|
| PubChem CID | 10529070 |
| Molecular Formula | C29H35NO4Si |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(phenylmethoxymethoxy)pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@H](OCOCc2ccccc2)C(=O)N1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H35NO4Si/c1-29(2,3)35(25-15-9-5-10-16-25,26-17-11-6-12-18-26)34-21-24-19-27(28(31)30-24)33-22-32-20-23-13-7-4-8-14-23/h4-18,24,27H,19-22H2,1-3H3,(H,30,31)/t24-,27-/m0/s1 |
| InChIKey | YXWPEXDNJQHFIB-IGKIAQTJSA-N |
| XLogP | 4.01 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|