C26H27NO4 — CID 164682624
(3R,4S,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-one (PubChem CID 164682624) has the molecular formula C26H27NO4 and a molecular weight of 417.50 g/mol. Its IUPAC name is (3R,4S,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-one.
| Compound Name | (3R,4S,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 164682624 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (3R,4S,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-one |
| SMILES | O=C1N[C@@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H27NO4/c28-26-25(31-18-22-14-8-3-9-15-22)24(30-17-21-12-6-2-7-13-21)23(27-26)19-29-16-20-10-4-1-5-11-20/h1-15,23-25H,16-19H2,(H,27,28)/t23-,24-,25+/m0/s1 |
| InChIKey | QLYIRCPWSGOZMA-CCDWMCETSA-N |
| XLogP | 3.87 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |