C31H35NO7Si — CID 25228081
[(3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-4-(phenylmethoxycarbonylamino)oxolan-3-yl] acetate (PubChem CID 25228081) has the molecular formula C31H35NO7Si and a molecular weight of 561.71 g/mol. Its IUPAC name is [(3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-4-(phenylmethoxycarbonylamino)oxolan-3-yl] acetate.
| Compound Name | [(3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-4-(phenylmethoxycarbonylamino)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 25228081 |
| Molecular Formula | C31H35NO7Si |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | [(3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-4-(phenylmethoxycarbonylamino)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H35NO7Si/c1-22(33)38-28-27(32-30(35)36-20-23-14-8-5-9-15-23)26(39-29(28)34)21-37-40(31(2,3)4,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,26-28H,20-21H2,1-4H3,(H,32,35)/t26-,27-,28+/m1/s1 |
| InChIKey | HOPBDIRUODQLCA-FCEKVYKBSA-N |
| XLogP | 3.72 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|