C24H50O8Si2 — CID 10530043
(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,3R,4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5-bis(methoxymethoxy)-3-methyloxan-2-yl]acetaldehyde (PubChem CID 10530043) has the molecular formula C24H50O8Si2 and a molecular weight of 522.83 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,3R,4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5-bis(methoxymethoxy)-3-methyloxan-2-yl]acetaldehyde.
| Compound Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,3R,4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5-bis(methoxymethoxy)-3-methyloxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 10530043 |
| Molecular Formula | C24H50O8Si2 |
| Molecular Weight | 522.83 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,3R,4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5-bis(methoxymethoxy)-3-methyloxan-2-yl]acetaldehyde |
| SMILES | COCO[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)O[C@@H]([C@@H](C=O)O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H]1OCOC |
| InChI | InChI=1S/C24H50O8Si2/c1-17-19(18(14-25)31-33(10,11)23(2,3)4)30-22(32-34(12,13)24(5,6)7)21(29-16-27-9)20(17)28-15-26-8/h14,17-22H,15-16H2,1-13H3/t17-,18+,19+,20+,21-,22+/m0/s1 |
| InChIKey | SZKOGHXPSDSSSP-LJUYRKFLSA-N |
| XLogP | 4.94 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.83 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|