C22H9BrF10N2O — CID 10531421
[5-[(5-bromo-1H-pyrrol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanol (PubChem CID 10531421) has the molecular formula C22H9BrF10N2O and a molecular weight of 587.21 g/mol. Its IUPAC name is [5-[(5-bromo-1H-pyrrol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanol.
| Compound Name | [5-[(5-bromo-1H-pyrrol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanol |
|---|---|
| PubChem CID | 10531421 |
| Molecular Formula | C22H9BrF10N2O |
| Molecular Weight | 587.21 g/mol |
| Exact Mass | 585.97 |
| IUPAC Name | [5-[(5-bromo-1H-pyrrol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanol |
| SMILES | OC(c1ccc(C(c2ccc(Br)[nH]2)c2c(F)c(F)c(F)c(F)c2F)[nH]1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H9BrF10N2O/c23-8-4-3-6(35-8)9(10-12(24)16(28)20(32)17(29)13(10)25)5-1-2-7(34-5)22(36)11-14(26)18(30)21(33)19(31)15(11)27/h1-4,9,22,34-36H |
| InChIKey | AHOLLSIONHUPSS-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.21 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|