C9H15N3O2S — CID 105357334
1-ethyl-3-methyl-4,5,6,7-tetrahydropyrazolo[5,4-b][1,4]thiazepine 8,8-dioxide (PubChem CID 105357334) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 1-ethyl-3-methyl-4,5,6,7-tetrahydropyrazolo[5,4-b][1,4]thiazepine 8,8-dioxide.
| Compound Name | 1-ethyl-3-methyl-4,5,6,7-tetrahydropyrazolo[5,4-b][1,4]thiazepine 8,8-dioxide |
|---|---|
| PubChem CID | 105357334 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-ethyl-3-methyl-4,5,6,7-tetrahydropyrazolo[5,4-b][1,4]thiazepine 8,8-dioxide |
| SMILES | CCn1nc(C)c2c1S(=O)(=O)CCCN2 |
| InChI | InChI=1S/C9H15N3O2S/c1-3-12-9-8(7(2)11-12)10-5-4-6-15(9,13)14/h10H,3-6H2,1-2H3 |
| InChIKey | WOLHGYPVQJMRAX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |