C17H26O3S — CID 10543009
methyl (3S,4R)-3-hydroxy-2,2,6-trimethyl-4-phenylsulfanylheptanoate (PubChem CID 10543009) has the molecular formula C17H26O3S and a molecular weight of 310.46 g/mol. Its IUPAC name is methyl (3S,4R)-3-hydroxy-2,2,6-trimethyl-4-phenylsulfanylheptanoate.
| Compound Name | methyl (3S,4R)-3-hydroxy-2,2,6-trimethyl-4-phenylsulfanylheptanoate |
|---|---|
| PubChem CID | 10543009 |
| Molecular Formula | C17H26O3S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | methyl (3S,4R)-3-hydroxy-2,2,6-trimethyl-4-phenylsulfanylheptanoate |
| SMILES | COC(=O)C(C)(C)[C@H](O)[C@@H](CC(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C17H26O3S/c1-12(2)11-14(21-13-9-7-6-8-10-13)15(18)17(3,4)16(19)20-5/h6-10,12,14-15,18H,11H2,1-5H3/t14-,15-/m1/s1 |
| InChIKey | NJVPQKUAVALXOB-HUUCEWRRSA-N |
| XLogP | 3.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |