C11H14N2O2 — CID 105458935
3-[3-(methylamino)propyl]-2,1-benzoxazol-5-ol (PubChem CID 105458935) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 3-[3-(methylamino)propyl]-2,1-benzoxazol-5-ol.
| Compound Name | 3-[3-(methylamino)propyl]-2,1-benzoxazol-5-ol |
|---|---|
| PubChem CID | 105458935 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3-[3-(methylamino)propyl]-2,1-benzoxazol-5-ol |
| SMILES | CNCCCc1onc2ccc(O)cc12 |
| InChI | InChI=1S/C11H14N2O2/c1-12-6-2-3-11-9-7-8(14)4-5-10(9)13-15-11/h4-5,7,12,14H,2-3,6H2,1H3 |
| InChIKey | ORQKUPRUOLJTHU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|