C12H13ClO2 — CID 105482540
7-chloro-2-methoxy-3,4-dihydro-1H-naphthalene-2-carbaldehyde (PubChem CID 105482540) has the molecular formula C12H13ClO2 and a molecular weight of 224.69 g/mol. Its IUPAC name is 7-chloro-2-methoxy-3,4-dihydro-1H-naphthalene-2-carbaldehyde.
| Compound Name | 7-chloro-2-methoxy-3,4-dihydro-1H-naphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 105482540 |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 7-chloro-2-methoxy-3,4-dihydro-1H-naphthalene-2-carbaldehyde |
| SMILES | COC1(C=O)CCc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C12H13ClO2/c1-15-12(8-14)5-4-9-2-3-11(13)6-10(9)7-12/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | MCDKGQHDTPYZHZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|