C26H45NO2Si — CID 10550650
(1S)-1-[(2S,6S)-1-benzyl-6-[2-tri(propan-2-yl)silyloxyethyl]-3,6-dihydro-2H-pyridin-2-yl]propan-1-ol (PubChem CID 10550650) has the molecular formula C26H45NO2Si and a molecular weight of 431.74 g/mol. Its IUPAC name is (1S)-1-[(2S,6S)-1-benzyl-6-[2-tri(propan-2-yl)silyloxyethyl]-3,6-dihydro-2H-pyridin-2-yl]propan-1-ol.
| Compound Name | (1S)-1-[(2S,6S)-1-benzyl-6-[2-tri(propan-2-yl)silyloxyethyl]-3,6-dihydro-2H-pyridin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 10550650 |
| Molecular Formula | C26H45NO2Si |
| Molecular Weight | 431.74 g/mol |
| Exact Mass | 431.32 |
| IUPAC Name | (1S)-1-[(2S,6S)-1-benzyl-6-[2-tri(propan-2-yl)silyloxyethyl]-3,6-dihydro-2H-pyridin-2-yl]propan-1-ol |
| SMILES | CC[C@H](O)[C@@H]1CC=C[C@H](CCO[Si](C(C)C)(C(C)C)C(C)C)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H45NO2Si/c1-8-26(28)25-16-12-15-24(27(25)19-23-13-10-9-11-14-23)17-18-29-30(20(2)3,21(4)5)22(6)7/h9-15,20-22,24-26,28H,8,16-19H2,1-7H3/t24-,25+,26+/m1/s1 |
| InChIKey | JQLPBGRWDPGMSS-ZNZIZOMTSA-N |
| XLogP | 6.54 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.74 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|