C30H54O6Si — CID 10554424
(5R,6S,7E,11Z)-5-acetyl-9-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-7,11-dienoic acid (PubChem CID 10554424) has the molecular formula C30H54O6Si and a molecular weight of 538.84 g/mol. Its IUPAC name is (5R,6S,7E,11Z)-5-acetyl-9-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-7,11-dienoic acid.
| Compound Name | (5R,6S,7E,11Z)-5-acetyl-9-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-7,11-dienoic acid |
|---|---|
| PubChem CID | 10554424 |
| Molecular Formula | C30H54O6Si |
| Molecular Weight | 538.84 g/mol |
| Exact Mass | 538.37 |
| IUPAC Name | (5R,6S,7E,11Z)-5-acetyl-9-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-7,11-dienoic acid |
| SMILES | CCCCC/C=C\CC(/C=C/[C@H]([C@H]1COC(C)(C)O1)[C@@H](CCCC(=O)O)C(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H54O6Si/c1-10-11-12-13-14-15-17-24(36-37(8,9)29(3,4)5)20-21-26(27-22-34-30(6,7)35-27)25(23(2)31)18-16-19-28(32)33/h14-15,20-21,24-27H,10-13,16-19,22H2,1-9H3,(H,32,33)/b15-14-,21-20+/t24?,25-,26-,27+/m0/s1 |
| InChIKey | GBLGKNZRGCMPNJ-FOAWLGGISA-N |
| XLogP | 7.69 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.84 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|