C30H31FN4O3S — CID 10554602
1-[1-(2-cyclopentylethyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 10554602) has the molecular formula C30H31FN4O3S and a molecular weight of 546.67 g/mol. Its IUPAC name is 1-[1-(2-cyclopentylethyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[1-(2-cyclopentylethyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 10554602 |
| Molecular Formula | C30H31FN4O3S |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 1-[1-(2-cyclopentylethyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | CSc1cccc(NC(=O)NC2C(=O)N(CCC3CCCC3)c3ccccc3N(c3ccccc3F)C2=O)c1 |
| InChI | InChI=1S/C30H31FN4O3S/c1-39-22-12-8-11-21(19-22)32-30(38)33-27-28(36)34(18-17-20-9-2-3-10-20)25-15-6-7-16-26(25)35(29(27)37)24-14-5-4-13-23(24)31/h4-8,11-16,19-20,27H,2-3,9-10,17-18H2,1H3,(H2,32,33,38) |
| InChIKey | NRARCHIWZOTYGP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|