C46H22F6N4Zn — CID 10557339
zinc 5,10,15-tris(2,6-difluorophenyl)-20-(4-ethynylphenyl)porphyrin-22,24-diide (PubChem CID 10557339) has the molecular formula C46H22F6N4Zn and a molecular weight of 810.09 g/mol. Its IUPAC name is zinc 5,10,15-tris(2,6-difluorophenyl)-20-(4-ethynylphenyl)porphyrin-22,24-diide.
| Compound Name | zinc 5,10,15-tris(2,6-difluorophenyl)-20-(4-ethynylphenyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 10557339 |
| Molecular Formula | C46H22F6N4Zn |
| Molecular Weight | 810.09 g/mol |
| Exact Mass | 808.10 |
| IUPAC Name | zinc 5,10,15-tris(2,6-difluorophenyl)-20-(4-ethynylphenyl)porphyrin-22,24-diide |
| SMILES | C#Cc1ccc(-c2c3nc(c(-c4c(F)cccc4F)c4ccc([n-]4)c(-c4c(F)cccc4F)c4nc(c(-c5c(F)cccc5F)c5ccc2[n-]5)C=C4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C46H22F6N4.Zn/c1-2-24-12-14-25(15-13-24)40-32-16-18-34(53-32)44(41-26(47)6-3-7-27(41)48)36-20-22-38(55-36)46(43-30(51)10-5-11-31(43)52)39-23-21-37(56-39)45(35-19-17-33(40)54-35)42-28(49)8-4-9-29(42)50;/h1,3-23H;/q-2;+2/b40-32-,40-33-,44-34+,44-36+,45-35+,45-37+,46-38+,46-39+; |
| InChIKey | DERVOSHXVUJAOY-JGBVRYQASA-N |
| XLogP | 11.40 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.09 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|