C48H24N8Zn — CID 25242649
zinc 4-[10,15,20-tris(4-cyanophenyl)porphyrin-22,24-diid-5-yl]benzonitrile (PubChem CID 25242649) has the molecular formula C48H24N8Zn and a molecular weight of 778.17 g/mol. Its IUPAC name is zinc 4-[10,15,20-tris(4-cyanophenyl)porphyrin-22,24-diid-5-yl]benzonitrile.
| Compound Name | zinc 4-[10,15,20-tris(4-cyanophenyl)porphyrin-22,24-diid-5-yl]benzonitrile |
|---|---|
| PubChem CID | 25242649 |
| Molecular Formula | C48H24N8Zn |
| Molecular Weight | 778.17 g/mol |
| Exact Mass | 776.14 |
| IUPAC Name | zinc 4-[10,15,20-tris(4-cyanophenyl)porphyrin-22,24-diid-5-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c3nc(c(-c4ccc(C#N)cc4)c4ccc([n-]4)c(-c4ccc(C#N)cc4)c4nc(c(-c5ccc(C#N)cc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C48H24N8.Zn/c49-25-29-1-9-33(10-2-29)45-37-17-19-39(53-37)46(34-11-3-30(26-50)4-12-34)41-21-23-43(55-41)48(36-15-7-32(28-52)8-16-36)44-24-22-42(56-44)47(40-20-18-38(45)54-40)35-13-5-31(27-51)6-14-35;/h1-24H;/q-2;+2/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44-; |
| InChIKey | AXGMVVYZHYEQJA-NHZJRHMYSA-N |
| XLogP | 10.07 |
| TPSA | 149.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.17 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|