C18H22NO2P — CID 10567336
4-diphenylphosphoryl-2,6-dimethylmorpholine (PubChem CID 10567336) has the molecular formula C18H22NO2P and a molecular weight of 315.35 g/mol. Its IUPAC name is 4-diphenylphosphoryl-2,6-dimethylmorpholine.
| Compound Name | 4-diphenylphosphoryl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 10567336 |
| Molecular Formula | C18H22NO2P |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-diphenylphosphoryl-2,6-dimethylmorpholine |
| SMILES | CC1CN(P(=O)(c2ccccc2)c2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C18H22NO2P/c1-15-13-19(14-16(2)21-15)22(20,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3 |
| InChIKey | IHCMXKATLMMNPR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|